C14H10ClFN4O — CID 105386639
N-(5-chloro-2-cyanophenyl)-3-fluoro-2-(methylamino)pyridine-4-carboxamide (PubChem CID 105386639) has the molecular formula C14H10ClFN4O and a molecular weight of 304.71 g/mol. Its IUPAC name is N-(5-chloro-2-cyanophenyl)-3-fluoro-2-(methylamino)pyridine-4-carboxamide.
| Compound Name | N-(5-chloro-2-cyanophenyl)-3-fluoro-2-(methylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105386639 |
| Molecular Formula | C14H10ClFN4O |
| Molecular Weight | 304.71 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | N-(5-chloro-2-cyanophenyl)-3-fluoro-2-(methylamino)pyridine-4-carboxamide |
| SMILES | CNc1nccc(C(=O)Nc2cc(Cl)ccc2C#N)c1F |
| InChI | InChI=1S/C14H10ClFN4O/c1-18-13-12(16)10(4-5-19-13)14(21)20-11-6-9(15)3-2-8(11)7-17/h2-6H,1H3,(H,18,19)(H,20,21) |
| InChIKey | GFVDXALTJQEQGE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.71 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |