C14H13F2N3O — CID 105383951
3-fluoro-N-(2-fluoro-4-methylphenyl)-2-(methylamino)pyridine-4-carboxamide (PubChem CID 105383951) has the molecular formula C14H13F2N3O and a molecular weight of 277.27 g/mol. Its IUPAC name is 3-fluoro-N-(2-fluoro-4-methylphenyl)-2-(methylamino)pyridine-4-carboxamide.
| Compound Name | 3-fluoro-N-(2-fluoro-4-methylphenyl)-2-(methylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105383951 |
| Molecular Formula | C14H13F2N3O |
| Molecular Weight | 277.27 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 3-fluoro-N-(2-fluoro-4-methylphenyl)-2-(methylamino)pyridine-4-carboxamide |
| SMILES | CNc1nccc(C(=O)Nc2ccc(C)cc2F)c1F |
| InChI | InChI=1S/C14H13F2N3O/c1-8-3-4-11(10(15)7-8)19-14(20)9-5-6-18-13(17-2)12(9)16/h3-7H,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | NSQNMQQNHNUIEF-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.27 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |