C14H12BrF2N3O — CID 105387648
N-(4-bromo-5-fluoro-2-methylphenyl)-3-fluoro-2-(methylamino)pyridine-4-carboxamide (PubChem CID 105387648) has the molecular formula C14H12BrF2N3O and a molecular weight of 356.17 g/mol. Its IUPAC name is N-(4-bromo-5-fluoro-2-methylphenyl)-3-fluoro-2-(methylamino)pyridine-4-carboxamide.
| Compound Name | N-(4-bromo-5-fluoro-2-methylphenyl)-3-fluoro-2-(methylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105387648 |
| Molecular Formula | C14H12BrF2N3O |
| Molecular Weight | 356.17 g/mol |
| Exact Mass | 355.01 |
| IUPAC Name | N-(4-bromo-5-fluoro-2-methylphenyl)-3-fluoro-2-(methylamino)pyridine-4-carboxamide |
| SMILES | CNc1nccc(C(=O)Nc2cc(F)c(Br)cc2C)c1F |
| InChI | InChI=1S/C14H12BrF2N3O/c1-7-5-9(15)10(16)6-11(7)20-14(21)8-3-4-19-13(18-2)12(8)17/h3-6H,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | RAVMGUDLDQAHKC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.17 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |