C15H24FN3O — CID 105388788
N-[[3-fluoro-2-(2-methylmorpholin-4-yl)-4-pyridinyl]methyl]-2-methylpropan-1-amine (PubChem CID 105388788) has the molecular formula C15H24FN3O and a molecular weight of 281.37 g/mol. Its IUPAC name is N-[[3-fluoro-2-(2-methylmorpholin-4-yl)-4-pyridinyl]methyl]-2-methylpropan-1-amine.
| Compound Name | N-[[3-fluoro-2-(2-methylmorpholin-4-yl)-4-pyridinyl]methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 105388788 |
| Molecular Formula | C15H24FN3O |
| Molecular Weight | 281.37 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | N-[[3-fluoro-2-(2-methylmorpholin-4-yl)-4-pyridinyl]methyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCc1ccnc(N2CCOC(C)C2)c1F |
| InChI | InChI=1S/C15H24FN3O/c1-11(2)8-17-9-13-4-5-18-15(14(13)16)19-6-7-20-12(3)10-19/h4-5,11-12,17H,6-10H2,1-3H3 |
| InChIKey | RUSGZUFFFUZPFF-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |