C16H26FN3S — CID 105390466
N-[[2-(2-ethylthiomorpholin-4-yl)-3-fluoro-4-pyridinyl]methyl]-2-methylpropan-1-amine (PubChem CID 105390466) has the molecular formula C16H26FN3S and a molecular weight of 311.47 g/mol. Its IUPAC name is N-[[2-(2-ethylthiomorpholin-4-yl)-3-fluoro-4-pyridinyl]methyl]-2-methylpropan-1-amine.
| Compound Name | N-[[2-(2-ethylthiomorpholin-4-yl)-3-fluoro-4-pyridinyl]methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 105390466 |
| Molecular Formula | C16H26FN3S |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | N-[[2-(2-ethylthiomorpholin-4-yl)-3-fluoro-4-pyridinyl]methyl]-2-methylpropan-1-amine |
| SMILES | CCC1CN(c2nccc(CNCC(C)C)c2F)CCS1 |
| InChI | InChI=1S/C16H26FN3S/c1-4-14-11-20(7-8-21-14)16-15(17)13(5-6-19-16)10-18-9-12(2)3/h5-6,12,14,18H,4,7-11H2,1-3H3 |
| InChIKey | KCSMPHDDPLCHMD-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |