C17H26FN3 — CID 105389757
1-[2-(3-azaspiro[5.5]undecan-3-yl)-3-fluoro-4-pyridinyl]-N-methylmethanamine (PubChem CID 105389757) has the molecular formula C17H26FN3 and a molecular weight of 291.41 g/mol. Its IUPAC name is 1-[2-(3-azaspiro[5.5]undecan-3-yl)-3-fluoro-4-pyridinyl]-N-methylmethanamine.
| Compound Name | 1-[2-(3-azaspiro[5.5]undecan-3-yl)-3-fluoro-4-pyridinyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 105389757 |
| Molecular Formula | C17H26FN3 |
| Molecular Weight | 291.41 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | 1-[2-(3-azaspiro[5.5]undecan-3-yl)-3-fluoro-4-pyridinyl]-N-methylmethanamine |
| SMILES | CNCc1ccnc(N2CCC3(CCCCC3)CC2)c1F |
| InChI | InChI=1S/C17H26FN3/c1-19-13-14-5-10-20-16(15(14)18)21-11-8-17(9-12-21)6-3-2-4-7-17/h5,10,19H,2-4,6-9,11-13H2,1H3 |
| InChIKey | NQFMPVSGOGUEDZ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |