C16H27FN4 — CID 105390101
4-(ethylaminomethyl)-N-[(1-ethylpyrrolidin-2-yl)methyl]-3-fluoro-N-methylpyridin-2-amine (PubChem CID 105390101) has the molecular formula C16H27FN4 and a molecular weight of 294.42 g/mol. Its IUPAC name is 4-(ethylaminomethyl)-N-[(1-ethylpyrrolidin-2-yl)methyl]-3-fluoro-N-methylpyridin-2-amine.
| Compound Name | 4-(ethylaminomethyl)-N-[(1-ethylpyrrolidin-2-yl)methyl]-3-fluoro-N-methylpyridin-2-amine |
|---|---|
| PubChem CID | 105390101 |
| Molecular Formula | C16H27FN4 |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | 4-(ethylaminomethyl)-N-[(1-ethylpyrrolidin-2-yl)methyl]-3-fluoro-N-methylpyridin-2-amine |
| SMILES | CCNCc1ccnc(N(C)CC2CCCN2CC)c1F |
| InChI | InChI=1S/C16H27FN4/c1-4-18-11-13-8-9-19-16(15(13)17)20(3)12-14-7-6-10-21(14)5-2/h8-9,14,18H,4-7,10-12H2,1-3H3 |
| InChIKey | ORWPLKYFKGFUSG-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |