C15H24N4O2 — CID 79309782
methyl 3-amino-2-[(1-ethylpyrrolidin-2-yl)methyl-methylamino]pyridine-4-carboxylate (PubChem CID 79309782) has the molecular formula C15H24N4O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is methyl 3-amino-2-[(1-ethylpyrrolidin-2-yl)methyl-methylamino]pyridine-4-carboxylate.
| Compound Name | methyl 3-amino-2-[(1-ethylpyrrolidin-2-yl)methyl-methylamino]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 79309782 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | methyl 3-amino-2-[(1-ethylpyrrolidin-2-yl)methyl-methylamino]pyridine-4-carboxylate |
| SMILES | CCN1CCCC1CN(C)c1nccc(C(=O)OC)c1N |
| InChI | InChI=1S/C15H24N4O2/c1-4-19-9-5-6-11(19)10-18(2)14-13(16)12(7-8-17-14)15(20)21-3/h7-8,11H,4-6,9-10,16H2,1-3H3 |
| InChIKey | LYWDRLQKIMFBBG-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |