C14H16F2N4 — CID 105392285
[3-[(2,3-difluorophenyl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-7-yl]methanamine (PubChem CID 105392285) has the molecular formula C14H16F2N4 and a molecular weight of 278.31 g/mol. Its IUPAC name is [3-[(2,3-difluorophenyl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-7-yl]methanamine.
| Compound Name | [3-[(2,3-difluorophenyl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-7-yl]methanamine |
|---|---|
| PubChem CID | 105392285 |
| Molecular Formula | C14H16F2N4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | [3-[(2,3-difluorophenyl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-7-yl]methanamine |
| SMILES | NCC1CCn2c(Cc3cccc(F)c3F)nnc2C1 |
| InChI | InChI=1S/C14H16F2N4/c15-11-3-1-2-10(14(11)16)7-13-19-18-12-6-9(8-17)4-5-20(12)13/h1-3,9H,4-8,17H2 |
| InChIKey | BSEAUWXENQHODT-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |