C16H30N4 — CID 105392323
(3-nonyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-7-yl)methanamine (PubChem CID 105392323) has the molecular formula C16H30N4 and a molecular weight of 278.44 g/mol. Its IUPAC name is (3-nonyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-7-yl)methanamine.
| Compound Name | (3-nonyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-7-yl)methanamine |
|---|---|
| PubChem CID | 105392323 |
| Molecular Formula | C16H30N4 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.25 |
| IUPAC Name | (3-nonyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-7-yl)methanamine |
| SMILES | CCCCCCCCCc1nnc2n1CCC(CN)C2 |
| InChI | InChI=1S/C16H30N4/c1-2-3-4-5-6-7-8-9-15-18-19-16-12-14(13-17)10-11-20(15)16/h14H,2-13,17H2,1H3 |
| InChIKey | LWTNQERCVFPLPJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|