C13H20N6 — CID 105392334
[3-(3-ethyl-1-methylpyrazol-5-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-7-yl]methanamine (PubChem CID 105392334) has the molecular formula C13H20N6 and a molecular weight of 260.34 g/mol. Its IUPAC name is [3-(3-ethyl-1-methylpyrazol-5-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-7-yl]methanamine.
| Compound Name | [3-(3-ethyl-1-methylpyrazol-5-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-7-yl]methanamine |
|---|---|
| PubChem CID | 105392334 |
| Molecular Formula | C13H20N6 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | [3-(3-ethyl-1-methylpyrazol-5-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-7-yl]methanamine |
| SMILES | CCc1cc(-c2nnc3n2CCC(CN)C3)n(C)n1 |
| InChI | InChI=1S/C13H20N6/c1-3-10-7-11(18(2)17-10)13-16-15-12-6-9(8-14)4-5-19(12)13/h7,9H,3-6,8,14H2,1-2H3 |
| InChIKey | PJRDDUNITXCDKR-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |