C15H18ClN3O2 — CID 105393643
methyl 8-chloro-3-(2,2,3,3-tetramethylcyclopropyl)-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylate (PubChem CID 105393643) has the molecular formula C15H18ClN3O2 and a molecular weight of 307.78 g/mol. Its IUPAC name is methyl 8-chloro-3-(2,2,3,3-tetramethylcyclopropyl)-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylate.
| Compound Name | methyl 8-chloro-3-(2,2,3,3-tetramethylcyclopropyl)-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 105393643 |
| Molecular Formula | C15H18ClN3O2 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | methyl 8-chloro-3-(2,2,3,3-tetramethylcyclopropyl)-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylate |
| SMILES | COC(=O)c1cc(Cl)c2nnc(C3C(C)(C)C3(C)C)n2c1 |
| InChI | InChI=1S/C15H18ClN3O2/c1-14(2)10(15(14,3)4)12-18-17-11-9(16)6-8(7-19(11)12)13(20)21-5/h6-7,10H,1-5H3 |
| InChIKey | QKZCPPOLQVWIPC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |