C10H5ClF5N3O2 — CID 105393688
methyl 8-chloro-3-(1,1,2,2,2-pentafluoroethyl)-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylate (PubChem CID 105393688) has the molecular formula C10H5ClF5N3O2 and a molecular weight of 329.61 g/mol. Its IUPAC name is methyl 8-chloro-3-(1,1,2,2,2-pentafluoroethyl)-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylate.
| Compound Name | methyl 8-chloro-3-(1,1,2,2,2-pentafluoroethyl)-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 105393688 |
| Molecular Formula | C10H5ClF5N3O2 |
| Molecular Weight | 329.61 g/mol |
| Exact Mass | 329.00 |
| IUPAC Name | methyl 8-chloro-3-(1,1,2,2,2-pentafluoroethyl)-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylate |
| SMILES | COC(=O)c1cc(Cl)c2nnc(C(F)(F)C(F)(F)F)n2c1 |
| InChI | InChI=1S/C10H5ClF5N3O2/c1-21-7(20)4-2-5(11)6-17-18-8(19(6)3-4)9(12,13)10(14,15)16/h2-3H,1H3 |
| InChIKey | WWZQNILHACQJQF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.61 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|