C11H6Cl2N4 — CID 10539590
1-(2,6-dichloropyrimidin-4-yl)benzimidazole (PubChem CID 10539590) has the molecular formula C11H6Cl2N4 and a molecular weight of 265.10 g/mol. Its IUPAC name is 1-(2,6-dichloropyrimidin-4-yl)benzimidazole.
| Compound Name | 1-(2,6-dichloropyrimidin-4-yl)benzimidazole |
|---|---|
| PubChem CID | 10539590 |
| Molecular Formula | C11H6Cl2N4 |
| Molecular Weight | 265.10 g/mol |
| Exact Mass | 264.00 |
| IUPAC Name | 1-(2,6-dichloropyrimidin-4-yl)benzimidazole |
| SMILES | Clc1cc(-n2cnc3ccccc32)nc(Cl)n1 |
| InChI | InChI=1S/C11H6Cl2N4/c12-9-5-10(16-11(13)15-9)17-6-14-7-3-1-2-4-8(7)17/h1-6H |
| InChIKey | IAPCOUOUKCFBNL-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.10 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |