C17H18N2O — CID 10539704
10-phenyl-2,3,6,7,8,9-hexahydro-1H-imidazo[1,2-b]isoquinolin-5-one (PubChem CID 10539704) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is 10-phenyl-2,3,6,7,8,9-hexahydro-1H-imidazo[1,2-b]isoquinolin-5-one.
| Compound Name | 10-phenyl-2,3,6,7,8,9-hexahydro-1H-imidazo[1,2-b]isoquinolin-5-one |
|---|---|
| PubChem CID | 10539704 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 10-phenyl-2,3,6,7,8,9-hexahydro-1H-imidazo[1,2-b]isoquinolin-5-one |
| SMILES | O=c1c2c(c(-c3ccccc3)c3n1CCN3)CCCC2 |
| InChI | InChI=1S/C17H18N2O/c20-17-14-9-5-4-8-13(14)15(12-6-2-1-3-7-12)16-18-10-11-19(16)17/h1-3,6-7,18H,4-5,8-11H2 |
| InChIKey | YRCGBCNRJVRXPU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |