C16H16ClFO — CID 105397604
1-(2-chloro-5-fluorophenyl)-3-(3-methylphenyl)propan-1-ol (PubChem CID 105397604) has the molecular formula C16H16ClFO and a molecular weight of 278.75 g/mol. Its IUPAC name is 1-(2-chloro-5-fluorophenyl)-3-(3-methylphenyl)propan-1-ol.
| Compound Name | 1-(2-chloro-5-fluorophenyl)-3-(3-methylphenyl)propan-1-ol |
|---|---|
| PubChem CID | 105397604 |
| Molecular Formula | C16H16ClFO |
| Molecular Weight | 278.75 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 1-(2-chloro-5-fluorophenyl)-3-(3-methylphenyl)propan-1-ol |
| SMILES | Cc1cccc(CCC(O)c2cc(F)ccc2Cl)c1 |
| InChI | InChI=1S/C16H16ClFO/c1-11-3-2-4-12(9-11)5-8-16(19)14-10-13(18)6-7-15(14)17/h2-4,6-7,9-10,16,19H,5,8H2,1H3 |
| InChIKey | HENLFFZEQLAKCL-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.75 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |