C16H14F2N2S — CID 105403388
1-[(3,5-difluorophenyl)methyl]-4-methylsulfanylindol-6-amine (PubChem CID 105403388) has the molecular formula C16H14F2N2S and a molecular weight of 304.37 g/mol. Its IUPAC name is 1-[(3,5-difluorophenyl)methyl]-4-methylsulfanylindol-6-amine.
| Compound Name | 1-[(3,5-difluorophenyl)methyl]-4-methylsulfanylindol-6-amine |
|---|---|
| PubChem CID | 105403388 |
| Molecular Formula | C16H14F2N2S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 1-[(3,5-difluorophenyl)methyl]-4-methylsulfanylindol-6-amine |
| SMILES | CSc1cc(N)cc2c1ccn2Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C16H14F2N2S/c1-21-16-8-13(19)7-15-14(16)2-3-20(15)9-10-4-11(17)6-12(18)5-10/h2-8H,9,19H2,1H3 |
| InChIKey | RXBVHQXMXISQOH-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|