C17H15FN2OS — CID 5112696
2-[1-[(4-fluorophenyl)methyl]indol-3-yl]sulfanylacetamide (PubChem CID 5112696) has the molecular formula C17H15FN2OS and a molecular weight of 314.39 g/mol. Its IUPAC name is 2-[1-[(4-fluorophenyl)methyl]indol-3-yl]sulfanylacetamide.
| Compound Name | 2-[1-[(4-fluorophenyl)methyl]indol-3-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 5112696 |
| Molecular Formula | C17H15FN2OS |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 2-[1-[(4-fluorophenyl)methyl]indol-3-yl]sulfanylacetamide |
| SMILES | NC(=O)CSc1cn(Cc2ccc(F)cc2)c2ccccc12 |
| InChI | InChI=1S/C17H15FN2OS/c18-13-7-5-12(6-8-13)9-20-10-16(22-11-17(19)21)14-3-1-2-4-15(14)20/h1-8,10H,9,11H2,(H2,19,21) |
| InChIKey | NDGGRVNOOOYYCD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |