C16H21NOS — CID 10540370
(3Z)-3,4,6,8-tetramethyl-5,6-dihydro-2H-1,8-benzothiazecin-7-one (PubChem CID 10540370) has the molecular formula C16H21NOS and a molecular weight of 275.42 g/mol. Its IUPAC name is (3Z)-3,4,6,8-tetramethyl-5,6-dihydro-2H-1,8-benzothiazecin-7-one.
| Compound Name | (3Z)-3,4,6,8-tetramethyl-5,6-dihydro-2H-1,8-benzothiazecin-7-one |
|---|---|
| PubChem CID | 10540370 |
| Molecular Formula | C16H21NOS |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | (3Z)-3,4,6,8-tetramethyl-5,6-dihydro-2H-1,8-benzothiazecin-7-one |
| SMILES | C/C1=C(\C)CC(C)C(=O)N(C)c2ccccc2SC1 |
| InChI | InChI=1S/C16H21NOS/c1-11-9-12(2)16(18)17(4)14-7-5-6-8-15(14)19-10-13(11)3/h5-8,12H,9-10H2,1-4H3/b13-11- |
| InChIKey | NLVXCRWYJIHPEP-QBFSEMIESA-N |
| XLogP | 4.12 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|