C14H12ClF2NO — CID 105404335
2-(chloromethyl)-3-[(3,5-difluorophenyl)methoxy]-6-methylpyridine (PubChem CID 105404335) has the molecular formula C14H12ClF2NO and a molecular weight of 283.71 g/mol. Its IUPAC name is 2-(chloromethyl)-3-[(3,5-difluorophenyl)methoxy]-6-methylpyridine.
| Compound Name | 2-(chloromethyl)-3-[(3,5-difluorophenyl)methoxy]-6-methylpyridine |
|---|---|
| PubChem CID | 105404335 |
| Molecular Formula | C14H12ClF2NO |
| Molecular Weight | 283.71 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 2-(chloromethyl)-3-[(3,5-difluorophenyl)methoxy]-6-methylpyridine |
| SMILES | Cc1ccc(OCc2cc(F)cc(F)c2)c(CCl)n1 |
| InChI | InChI=1S/C14H12ClF2NO/c1-9-2-3-14(13(7-15)18-9)19-8-10-4-11(16)6-12(17)5-10/h2-6H,7-8H2,1H3 |
| InChIKey | MJUODUJHJNMMCF-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.71 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|