C14H12Cl3NO — CID 79169539
2-(chloromethyl)-3-[(2,6-dichlorophenyl)methoxy]-6-methylpyridine (PubChem CID 79169539) has the molecular formula C14H12Cl3NO and a molecular weight of 316.62 g/mol. Its IUPAC name is 2-(chloromethyl)-3-[(2,6-dichlorophenyl)methoxy]-6-methylpyridine.
| Compound Name | 2-(chloromethyl)-3-[(2,6-dichlorophenyl)methoxy]-6-methylpyridine |
|---|---|
| PubChem CID | 79169539 |
| Molecular Formula | C14H12Cl3NO |
| Molecular Weight | 316.62 g/mol |
| Exact Mass | 315.00 |
| IUPAC Name | 2-(chloromethyl)-3-[(2,6-dichlorophenyl)methoxy]-6-methylpyridine |
| SMILES | Cc1ccc(OCc2c(Cl)cccc2Cl)c(CCl)n1 |
| InChI | InChI=1S/C14H12Cl3NO/c1-9-5-6-14(13(7-15)18-9)19-8-10-11(16)3-2-4-12(10)17/h2-6H,7-8H2,1H3 |
| InChIKey | RRHGCTRYYAVSOS-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.62 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|