C17H16F2O2 — CID 105405677
2-(3,5-difluorophenyl)-1-(3,4-dihydro-2H-chromen-3-yl)ethanol (PubChem CID 105405677) has the molecular formula C17H16F2O2 and a molecular weight of 290.31 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)-1-(3,4-dihydro-2H-chromen-3-yl)ethanol.
| Compound Name | 2-(3,5-difluorophenyl)-1-(3,4-dihydro-2H-chromen-3-yl)ethanol |
|---|---|
| PubChem CID | 105405677 |
| Molecular Formula | C17H16F2O2 |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 2-(3,5-difluorophenyl)-1-(3,4-dihydro-2H-chromen-3-yl)ethanol |
| SMILES | OC(Cc1cc(F)cc(F)c1)C1COc2ccccc2C1 |
| InChI | InChI=1S/C17H16F2O2/c18-14-5-11(6-15(19)9-14)7-16(20)13-8-12-3-1-2-4-17(12)21-10-13/h1-6,9,13,16,20H,7-8,10H2 |
| InChIKey | DFZYUVRVQADFAQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |