C16H26F2N2 — CID 105406565
4-(3,5-difluorophenyl)-1-N,1-N,3-N-triethylbutane-1,3-diamine (PubChem CID 105406565) has the molecular formula C16H26F2N2 and a molecular weight of 284.39 g/mol. Its IUPAC name is 4-(3,5-difluorophenyl)-1-N,1-N,3-N-triethylbutane-1,3-diamine.
| Compound Name | 4-(3,5-difluorophenyl)-1-N,1-N,3-N-triethylbutane-1,3-diamine |
|---|---|
| PubChem CID | 105406565 |
| Molecular Formula | C16H26F2N2 |
| Molecular Weight | 284.39 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | 4-(3,5-difluorophenyl)-1-N,1-N,3-N-triethylbutane-1,3-diamine |
| SMILES | CCNC(CCN(CC)CC)Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C16H26F2N2/c1-4-19-16(7-8-20(5-2)6-3)11-13-9-14(17)12-15(18)10-13/h9-10,12,16,19H,4-8,11H2,1-3H3 |
| InChIKey | UJXKZJNVZJVXJH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |