C11H12F2OS — CID 105407728
4-[(3,5-difluorophenyl)methyl]thiolan-3-ol (PubChem CID 105407728) has the molecular formula C11H12F2OS and a molecular weight of 230.28 g/mol. Its IUPAC name is 4-[(3,5-difluorophenyl)methyl]thiolan-3-ol.
| Compound Name | 4-[(3,5-difluorophenyl)methyl]thiolan-3-ol |
|---|---|
| PubChem CID | 105407728 |
| Molecular Formula | C11H12F2OS |
| Molecular Weight | 230.28 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 4-[(3,5-difluorophenyl)methyl]thiolan-3-ol |
| SMILES | OC1CSCC1Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C11H12F2OS/c12-9-2-7(3-10(13)4-9)1-8-5-15-6-11(8)14/h2-4,8,11,14H,1,5-6H2 |
| InChIKey | BDCWAAZSSKEZST-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.28 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |