C9H11BrOS2 — CID 83190729
4-[(4-bromothiophen-2-yl)methyl]thiolan-3-ol (PubChem CID 83190729) has the molecular formula C9H11BrOS2 and a molecular weight of 279.22 g/mol. Its IUPAC name is 4-[(4-bromothiophen-2-yl)methyl]thiolan-3-ol.
| Compound Name | 4-[(4-bromothiophen-2-yl)methyl]thiolan-3-ol |
|---|---|
| PubChem CID | 83190729 |
| Molecular Formula | C9H11BrOS2 |
| Molecular Weight | 279.22 g/mol |
| Exact Mass | 277.94 |
| IUPAC Name | 4-[(4-bromothiophen-2-yl)methyl]thiolan-3-ol |
| SMILES | OC1CSCC1Cc1cc(Br)cs1 |
| InChI | InChI=1S/C9H11BrOS2/c10-7-2-8(13-4-7)1-6-3-12-5-9(6)11/h2,4,6,9,11H,1,3,5H2 |
| InChIKey | JQOAHLPSBKCCCX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.22 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |