C15H21BrO2S — CID 81021307
2-[(4-bromothiophen-2-yl)methyl]-4-propylcyclohexane-1-carboxylic acid (PubChem CID 81021307) has the molecular formula C15H21BrO2S and a molecular weight of 345.30 g/mol. Its IUPAC name is 2-[(4-bromothiophen-2-yl)methyl]-4-propylcyclohexane-1-carboxylic acid.
| Compound Name | 2-[(4-bromothiophen-2-yl)methyl]-4-propylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 81021307 |
| Molecular Formula | C15H21BrO2S |
| Molecular Weight | 345.30 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | 2-[(4-bromothiophen-2-yl)methyl]-4-propylcyclohexane-1-carboxylic acid |
| SMILES | CCCC1CCC(C(=O)O)C(Cc2cc(Br)cs2)C1 |
| InChI | InChI=1S/C15H21BrO2S/c1-2-3-10-4-5-14(15(17)18)11(6-10)7-13-8-12(16)9-19-13/h8-11,14H,2-7H2,1H3,(H,17,18) |
| InChIKey | ZZJLJEQZRLOTKK-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.30 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |