C14H24O2 — CID 81020893
2-but-3-enyl-4-propylcyclohexane-1-carboxylic acid (PubChem CID 81020893) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is 2-but-3-enyl-4-propylcyclohexane-1-carboxylic acid.
| Compound Name | 2-but-3-enyl-4-propylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 81020893 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | 2-but-3-enyl-4-propylcyclohexane-1-carboxylic acid |
| SMILES | C=CCCC1CC(CCC)CCC1C(=O)O |
| InChI | InChI=1S/C14H24O2/c1-3-5-7-12-10-11(6-4-2)8-9-13(12)14(15)16/h3,11-13H,1,4-10H2,2H3,(H,15,16) |
| InChIKey | YNBYFGZPGKNIJU-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|