C16H28O2 — CID 81021329
4-tert-butyl-2-pent-4-enylcyclohexane-1-carboxylic acid (PubChem CID 81021329) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is 4-tert-butyl-2-pent-4-enylcyclohexane-1-carboxylic acid.
| Compound Name | 4-tert-butyl-2-pent-4-enylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 81021329 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | 4-tert-butyl-2-pent-4-enylcyclohexane-1-carboxylic acid |
| SMILES | C=CCCCC1CC(C(C)(C)C)CCC1C(=O)O |
| InChI | InChI=1S/C16H28O2/c1-5-6-7-8-12-11-13(16(2,3)4)9-10-14(12)15(17)18/h5,12-14H,1,6-11H2,2-4H3,(H,17,18) |
| InChIKey | DASGBFIDKONAER-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|