C15H28O4S — CID 81020996
4-tert-butyl-2-(3-methylsulfonylpropyl)cyclohexane-1-carboxylic acid (PubChem CID 81020996) has the molecular formula C15H28O4S and a molecular weight of 304.45 g/mol. Its IUPAC name is 4-tert-butyl-2-(3-methylsulfonylpropyl)cyclohexane-1-carboxylic acid.
| Compound Name | 4-tert-butyl-2-(3-methylsulfonylpropyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 81020996 |
| Molecular Formula | C15H28O4S |
| Molecular Weight | 304.45 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 4-tert-butyl-2-(3-methylsulfonylpropyl)cyclohexane-1-carboxylic acid |
| SMILES | CC(C)(C)C1CCC(C(=O)O)C(CCCS(C)(=O)=O)C1 |
| InChI | InChI=1S/C15H28O4S/c1-15(2,3)12-7-8-13(14(16)17)11(10-12)6-5-9-20(4,18)19/h11-13H,5-10H2,1-4H3,(H,16,17) |
| InChIKey | QSVQROXHRIDDFJ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |