C14H26O4S — CID 81021131
4-ethyl-2-(3-ethylsulfonylpropyl)cyclohexane-1-carboxylic acid (PubChem CID 81021131) has the molecular formula C14H26O4S and a molecular weight of 290.42 g/mol. Its IUPAC name is 4-ethyl-2-(3-ethylsulfonylpropyl)cyclohexane-1-carboxylic acid.
| Compound Name | 4-ethyl-2-(3-ethylsulfonylpropyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 81021131 |
| Molecular Formula | C14H26O4S |
| Molecular Weight | 290.42 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 4-ethyl-2-(3-ethylsulfonylpropyl)cyclohexane-1-carboxylic acid |
| SMILES | CCC1CCC(C(=O)O)C(CCCS(=O)(=O)CC)C1 |
| InChI | InChI=1S/C14H26O4S/c1-3-11-7-8-13(14(15)16)12(10-11)6-5-9-19(17,18)4-2/h11-13H,3-10H2,1-2H3,(H,15,16) |
| InChIKey | HRGXPMYUKKEEQH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |