C34H60 — CID 91153190
2,7-ditert-butyl-9-[2-(3-pent-4-enylcyclopentyl)propan-2-yl]-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluorene (PubChem CID 91153190) has the molecular formula C34H60 and a molecular weight of 468.85 g/mol. Its IUPAC name is 2,7-ditert-butyl-9-[2-(3-pent-4-enylcyclopentyl)propan-2-yl]-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluorene.
| Compound Name | 2,7-ditert-butyl-9-[2-(3-pent-4-enylcyclopentyl)propan-2-yl]-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluorene |
|---|---|
| PubChem CID | 91153190 |
| Molecular Formula | C34H60 |
| Molecular Weight | 468.85 g/mol |
| Exact Mass | 468.47 |
| IUPAC Name | 2,7-ditert-butyl-9-[2-(3-pent-4-enylcyclopentyl)propan-2-yl]-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluorene |
| SMILES | C=CCCCC1CCC(C(C)(C)C2C3CC(C(C)(C)C)CCC3C3CCC(C(C)(C)C)CC32)C1 |
| InChI | InChI=1S/C34H60/c1-10-11-12-13-23-14-15-26(20-23)34(8,9)31-29-21-24(32(2,3)4)16-18-27(29)28-19-17-25(22-30(28)31)33(5,6)7/h10,23-31H,1,11-22H2,2-9H3 |
| InChIKey | UYSDKGKVVUZPJQ-UHFFFAOYSA-N |
| XLogP | 10.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.85 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|