C26H46 — CID 91406207
3-tert-butyl-9-[2-(3-methylcyclopentyl)propan-2-yl]-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluorene (PubChem CID 91406207) has the molecular formula C26H46 and a molecular weight of 358.65 g/mol. Its IUPAC name is 3-tert-butyl-9-[2-(3-methylcyclopentyl)propan-2-yl]-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluorene.
| Compound Name | 3-tert-butyl-9-[2-(3-methylcyclopentyl)propan-2-yl]-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluorene |
|---|---|
| PubChem CID | 91406207 |
| Molecular Formula | C26H46 |
| Molecular Weight | 358.65 g/mol |
| Exact Mass | 358.36 |
| IUPAC Name | 3-tert-butyl-9-[2-(3-methylcyclopentyl)propan-2-yl]-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluorene |
| SMILES | CC1CCC(C(C)(C)C2C3CCCCC3C3CC(C(C)(C)C)CCC32)C1 |
| InChI | InChI=1S/C26H46/c1-17-11-12-19(15-17)26(5,6)24-21-10-8-7-9-20(21)23-16-18(25(2,3)4)13-14-22(23)24/h17-24H,7-16H2,1-6H3 |
| InChIKey | RJGUDZGSWGYRMW-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.65 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |