C35H64 — CID 59582264
2,7-ditert-butyl-9-(5-cyclopentylnonan-5-yl)-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluorene (PubChem CID 59582264) has the molecular formula C35H64 and a molecular weight of 484.90 g/mol. Its IUPAC name is 2,7-ditert-butyl-9-(5-cyclopentylnonan-5-yl)-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluorene.
| Compound Name | 2,7-ditert-butyl-9-(5-cyclopentylnonan-5-yl)-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluorene |
|---|---|
| PubChem CID | 59582264 |
| Molecular Formula | C35H64 |
| Molecular Weight | 484.90 g/mol |
| Exact Mass | 484.50 |
| IUPAC Name | 2,7-ditert-butyl-9-(5-cyclopentylnonan-5-yl)-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluorene |
| SMILES | CCCCC(CCCC)(C1CCCC1)C1C2CC(C(C)(C)C)CCC2C2CCC(C(C)(C)C)CC21 |
| InChI | InChI=1S/C35H64/c1-9-11-21-35(22-12-10-2,25-15-13-14-16-25)32-30-23-26(33(3,4)5)17-19-28(30)29-20-18-27(24-31(29)32)34(6,7)8/h25-32H,9-24H2,1-8H3 |
| InChIKey | IIKFUBXBRFMWCF-UHFFFAOYSA-N |
| XLogP | 11.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.90 |
| LogP ≤ 5 | 11.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |