C72H130N2 — CID 140552752
2,6-ditert-butyl-9-N,10-N-bis[4-(4-hexylcyclohexyl)cyclohexyl]-9-N,10-N-bis(4-methylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a,9,9a,10,10a-tetradecahydroanthracene-9,10-diamine (PubChem CID 140552752) has the molecular formula C72H130N2 and a molecular weight of 1023.85 g/mol. Its IUPAC name is 2,6-ditert-butyl-9-N,10-N-bis[4-(4-hexylcyclohexyl)cyclohexyl]-9-N,10-N-bis(4-methylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a,9,9a,10,10a-tetradecahydroanthracene-9,10-diamine.
| Compound Name | 2,6-ditert-butyl-9-N,10-N-bis[4-(4-hexylcyclohexyl)cyclohexyl]-9-N,10-N-bis(4-methylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a,9,9a,10,10a-tetradecahydroanthracene-9,10-diamine |
|---|---|
| PubChem CID | 140552752 |
| Molecular Formula | C72H130N2 |
| Molecular Weight | 1023.85 g/mol |
| Exact Mass | 1023.02 |
| IUPAC Name | 2,6-ditert-butyl-9-N,10-N-bis[4-(4-hexylcyclohexyl)cyclohexyl]-9-N,10-N-bis(4-methylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a,9,9a,10,10a-tetradecahydroanthracene-9,10-diamine |
| SMILES | CCCCCCC1CCC(C2CCC(N(C3CCC(C)CC3)C3C4CCC(C(C)(C)C)CC4C(N(C4CCC(C)CC4)C4CCC(C5CCC(CCCCCC)CC5)CC4)C4CCC(C(C)(C)C)CC43)CC2)CC1 |
| InChI | InChI=1S/C72H130N2/c1-11-13-15-17-19-53-25-29-55(30-26-53)57-33-43-63(44-34-57)73(61-39-21-51(3)22-40-61)69-65-47-37-60(72(8,9)10)50-68(65)70(66-48-38-59(49-67(66)69)71(5,6)7)74(62-41-23-52(4)24-42-62)64-45-35-58(36-46-64)56-31-27-54(28-32-56)20-18-16-14-12-2/h51-70H,11-50H2,1-10H3 |
| InChIKey | PEYAHMSOVCMBDP-UHFFFAOYSA-N |
| XLogP | 21.33 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1023.85 |
| LogP ≤ 5 | 21.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|