About 1-tert-butyl-4-(4-pentylcyclohexyl)cyclohexane;ethane
1-tert-butyl-4-(4-pentylcyclohexyl)cyclohexane;ethane (PubChem CID 164591345) has the molecular formula C23H46
and a molecular weight of 322.62 g/mol. Its IUPAC name is 1-tert-butyl-4-(4-pentylcyclohexyl)cyclohexane;ethane.
Molecular Properties
| Compound Name | 1-tert-butyl-4-(4-pentylcyclohexyl)cyclohexane;ethane |
| PubChem CID | 164591345 |
| Molecular Formula | C23H46 |
| Molecular Weight | 322.62 g/mol |
| Exact Mass | 322.36 |
| IUPAC Name | 1-tert-butyl-4-(4-pentylcyclohexyl)cyclohexane;ethane |
| SMILES | CC.CCCCCC1CCC(C2CCC(C(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C21H40.C2H6/c1-5-6-7-8-17-9-11-18(12-10-17)19-13-15-20(16-14-19)21(2,3)4;1-2/h17-20H,5-16H2,1-4H3;1-2H3 |
| InChIKey | DKYHMBGTEKBACE-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.62 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-tert-butyl-4-(4-pentylcyclohexyl)cyclohexane;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-4-(4-pentylcyclohexyl)cyclohexane;ethane?
The IUPAC name of 1-tert-butyl-4-(4-pentylcyclohexyl)cyclohexane;ethane (CID 164591345) is 1-tert-butyl-4-(4-pentylcyclohexyl)cyclohexane;ethane.
What is the SMILES notation for 1-tert-butyl-4-(4-pentylcyclohexyl)cyclohexane;ethane?
The canonical SMILES for 1-tert-butyl-4-(4-pentylcyclohexyl)cyclohexane;ethane is CC.CCCCCC1CCC(C2CCC(C(C)(C)C)CC2)CC1.
What is the InChIKey of 1-tert-butyl-4-(4-pentylcyclohexyl)cyclohexane;ethane?
The InChIKey is DKYHMBGTEKBACE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H40.C2H6/c1-5-6-7-8-17-9-11-18(12-10-17)19-13-15-20(16-14-19)21(2,3)4;1-2/h17-20H,5-16H2,1-4H3;1-2H3.
What are the key properties of 1-tert-butyl-4-(4-pentylcyclohexyl)cyclohexane;ethane?
1-tert-butyl-4-(4-pentylcyclohexyl)cyclohexane;ethane has a molecular weight of 322.62 g/mol, XLogP of 8.25, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-4-(4-pentylcyclohexyl)cyclohexane;ethane is sourced from PubChem (CID 164591345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).