About ethane;1-ethyl-4-(4-pentylcyclohexyl)cyclohexane;methane
ethane;1-ethyl-4-(4-pentylcyclohexyl)cyclohexane;methane (PubChem CID 164590716) has the molecular formula C22H46
and a molecular weight of 310.61 g/mol. Its IUPAC name is ethane;1-ethyl-4-(4-pentylcyclohexyl)cyclohexane;methane.
Molecular Properties
| Compound Name | ethane;1-ethyl-4-(4-pentylcyclohexyl)cyclohexane;methane |
| PubChem CID | 164590716 |
| Molecular Formula | C22H46 |
| Molecular Weight | 310.61 g/mol |
| Exact Mass | 310.36 |
| IUPAC Name | ethane;1-ethyl-4-(4-pentylcyclohexyl)cyclohexane;methane |
| SMILES | C.CC.CCCCCC1CCC(C2CCC(CC)CC2)CC1 |
| InChI | InChI=1S/C19H36.C2H6.CH4/c1-3-5-6-7-17-10-14-19(15-11-17)18-12-8-16(4-2)9-13-18;1-2;/h16-19H,3-15H2,1-2H3;1-2H3;1H4 |
| InChIKey | IRWXKIHUQPAVAF-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.61 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-ethyl-4-(4-pentylcyclohexyl)cyclohexane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethyl-4-(4-pentylcyclohexyl)cyclohexane;methane?
The IUPAC name of ethane;1-ethyl-4-(4-pentylcyclohexyl)cyclohexane;methane (CID 164590716) is ethane;1-ethyl-4-(4-pentylcyclohexyl)cyclohexane;methane.
What is the SMILES notation for ethane;1-ethyl-4-(4-pentylcyclohexyl)cyclohexane;methane?
The canonical SMILES for ethane;1-ethyl-4-(4-pentylcyclohexyl)cyclohexane;methane is C.CC.CCCCCC1CCC(C2CCC(CC)CC2)CC1.
What is the InChIKey of ethane;1-ethyl-4-(4-pentylcyclohexyl)cyclohexane;methane?
The InChIKey is IRWXKIHUQPAVAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H36.C2H6.CH4/c1-3-5-6-7-17-10-14-19(15-11-17)18-12-8-16(4-2)9-13-18;1-2;/h16-19H,3-15H2,1-2H3;1-2H3;1H4.
What are the key properties of ethane;1-ethyl-4-(4-pentylcyclohexyl)cyclohexane;methane?
ethane;1-ethyl-4-(4-pentylcyclohexyl)cyclohexane;methane has a molecular weight of 310.61 g/mol, XLogP of 8.25, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethyl-4-(4-pentylcyclohexyl)cyclohexane;methane is sourced from PubChem (CID 164590716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).