C56H102N2 — CID 140552753
2,6-di(butan-2-yl)-9-N,10-N-bis(4-tert-butylcyclohexyl)-9-N,10-N-bis(4-methylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a,9,9a,10,10a-tetradecahydroanthracene-9,10-diamine (PubChem CID 140552753) has the molecular formula C56H102N2 and a molecular weight of 803.45 g/mol. Its IUPAC name is 2,6-di(butan-2-yl)-9-N,10-N-bis(4-tert-butylcyclohexyl)-9-N,10-N-bis(4-methylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a,9,9a,10,10a-tetradecahydroanthracene-9,10-diamine.
| Compound Name | 2,6-di(butan-2-yl)-9-N,10-N-bis(4-tert-butylcyclohexyl)-9-N,10-N-bis(4-methylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a,9,9a,10,10a-tetradecahydroanthracene-9,10-diamine |
|---|---|
| PubChem CID | 140552753 |
| Molecular Formula | C56H102N2 |
| Molecular Weight | 803.45 g/mol |
| Exact Mass | 802.80 |
| IUPAC Name | 2,6-di(butan-2-yl)-9-N,10-N-bis(4-tert-butylcyclohexyl)-9-N,10-N-bis(4-methylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a,9,9a,10,10a-tetradecahydroanthracene-9,10-diamine |
| SMILES | CCC(C)C1CCC2C(C1)C(N(C1CCC(C)CC1)C1CCC(C(C)(C)C)CC1)C1CCC(C(C)CC)CC1C2N(C1CCC(C)CC1)C1CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C56H102N2/c1-13-39(5)41-19-33-49-51(35-41)53(57(45-25-15-37(3)16-26-45)47-29-21-43(22-30-47)55(7,8)9)50-34-20-42(40(6)14-2)36-52(50)54(49)58(46-27-17-38(4)18-28-46)48-31-23-44(24-32-48)56(10,11)12/h37-54H,13-36H2,1-12H3 |
| InChIKey | ADJWSTASUVITNA-UHFFFAOYSA-N |
| XLogP | 15.87 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.45 |
| LogP ≤ 5 | 15.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |