C56H102N2O2 — CID 140552729
2,6-di(butan-2-yl)-9-N,10-N-bis(4-butoxycyclohexyl)-9-N,10-N-bis(4-methylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a,9,9a,10,10a-tetradecahydroanthracene-9,10-diamine (PubChem CID 140552729) has the molecular formula C56H102N2O2 and a molecular weight of 835.44 g/mol. Its IUPAC name is 2,6-di(butan-2-yl)-9-N,10-N-bis(4-butoxycyclohexyl)-9-N,10-N-bis(4-methylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a,9,9a,10,10a-tetradecahydroanthracene-9,10-diamine.
| Compound Name | 2,6-di(butan-2-yl)-9-N,10-N-bis(4-butoxycyclohexyl)-9-N,10-N-bis(4-methylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a,9,9a,10,10a-tetradecahydroanthracene-9,10-diamine |
|---|---|
| PubChem CID | 140552729 |
| Molecular Formula | C56H102N2O2 |
| Molecular Weight | 835.44 g/mol |
| Exact Mass | 834.79 |
| IUPAC Name | 2,6-di(butan-2-yl)-9-N,10-N-bis(4-butoxycyclohexyl)-9-N,10-N-bis(4-methylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a,9,9a,10,10a-tetradecahydroanthracene-9,10-diamine |
| SMILES | CCCCOC1CCC(N(C2CCC(C)CC2)C2C3CCC(C(C)CC)CC3C(N(C3CCC(C)CC3)C3CCC(OCCCC)CC3)C3CCC(C(C)CC)CC32)CC1 |
| InChI | InChI=1S/C56H102N2O2/c1-9-13-35-59-49-29-25-47(26-30-49)57(45-21-15-39(5)16-22-45)55-51-33-19-44(42(8)12-4)38-54(51)56(52-34-20-43(37-53(52)55)41(7)11-3)58(46-23-17-40(6)18-24-46)48-27-31-50(32-28-48)60-36-14-10-2/h39-56H,9-38H2,1-8H3 |
| InChIKey | PLFCTDZEIOZWLM-UHFFFAOYSA-N |
| XLogP | 14.91 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.44 |
| LogP ≤ 5 | 14.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|