C50H90N2 — CID 140552770
2,7-ditert-butyl-9-N,9-N,10-N,10-N-tetrakis(4-methylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a,9,9a,10,10a-tetradecahydroanthracene-9,10-diamine (PubChem CID 140552770) has the molecular formula C50H90N2 and a molecular weight of 719.28 g/mol. Its IUPAC name is 2,7-ditert-butyl-9-N,9-N,10-N,10-N-tetrakis(4-methylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a,9,9a,10,10a-tetradecahydroanthracene-9,10-diamine.
| Compound Name | 2,7-ditert-butyl-9-N,9-N,10-N,10-N-tetrakis(4-methylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a,9,9a,10,10a-tetradecahydroanthracene-9,10-diamine |
|---|---|
| PubChem CID | 140552770 |
| Molecular Formula | C50H90N2 |
| Molecular Weight | 719.28 g/mol |
| Exact Mass | 718.71 |
| IUPAC Name | 2,7-ditert-butyl-9-N,9-N,10-N,10-N-tetrakis(4-methylcyclohexyl)-1,2,3,4,4a,5,6,7,8,8a,9,9a,10,10a-tetradecahydroanthracene-9,10-diamine |
| SMILES | CC1CCC(N(C2CCC(C)CC2)C2C3CCC(C(C)(C)C)CC3C(N(C3CCC(C)CC3)C3CCC(C)CC3)C3CC(C(C)(C)C)CCC32)CC1 |
| InChI | InChI=1S/C50H90N2/c1-33-11-21-39(22-12-33)51(40-23-13-34(2)14-24-40)47-43-29-19-37(49(5,6)7)31-45(43)48(46-32-38(50(8,9)10)20-30-44(46)47)52(41-25-15-35(3)16-26-41)42-27-17-36(4)18-28-42/h33-48H,11-32H2,1-10H3 |
| InChIKey | PQEFFZRGLGUIOH-UHFFFAOYSA-N |
| XLogP | 13.81 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.28 |
| LogP ≤ 5 | 13.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |