C22H40O — CID 143233637
1-tert-butyl-3-[2-(4-prop-2-enoxycyclohexyl)propan-2-yl]cyclohexane (PubChem CID 143233637) has the molecular formula C22H40O and a molecular weight of 320.56 g/mol. Its IUPAC name is 1-tert-butyl-3-[2-(4-prop-2-enoxycyclohexyl)propan-2-yl]cyclohexane.
| Compound Name | 1-tert-butyl-3-[2-(4-prop-2-enoxycyclohexyl)propan-2-yl]cyclohexane |
|---|---|
| PubChem CID | 143233637 |
| Molecular Formula | C22H40O |
| Molecular Weight | 320.56 g/mol |
| Exact Mass | 320.31 |
| IUPAC Name | 1-tert-butyl-3-[2-(4-prop-2-enoxycyclohexyl)propan-2-yl]cyclohexane |
| SMILES | C=CCOC1CCC(C(C)(C)C2CCCC(C(C)(C)C)C2)CC1 |
| InChI | InChI=1S/C22H40O/c1-7-15-23-20-13-11-17(12-14-20)22(5,6)19-10-8-9-18(16-19)21(2,3)4/h7,17-20H,1,8-16H2,2-6H3 |
| InChIKey | BOFPTBSNIWIUHT-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.56 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|