C17H32O2 — CID 70671036
4-[2-(4-ethoxycyclohexyl)propan-2-yl]cyclohexan-1-ol (PubChem CID 70671036) has the molecular formula C17H32O2 and a molecular weight of 268.44 g/mol. Its IUPAC name is 4-[2-(4-ethoxycyclohexyl)propan-2-yl]cyclohexan-1-ol.
| Compound Name | 4-[2-(4-ethoxycyclohexyl)propan-2-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 70671036 |
| Molecular Formula | C17H32O2 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.24 |
| IUPAC Name | 4-[2-(4-ethoxycyclohexyl)propan-2-yl]cyclohexan-1-ol |
| SMILES | CCOC1CCC(C(C)(C)C2CCC(O)CC2)CC1 |
| InChI | InChI=1S/C17H32O2/c1-4-19-16-11-7-14(8-12-16)17(2,3)13-5-9-15(18)10-6-13/h13-16,18H,4-12H2,1-3H3 |
| InChIKey | NOSNAQBHLNFZCO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |