C38H64O6 — CID 118282146
2-[[4-[2-[4-[1,1-bis[4-(oxiran-2-ylmethoxy)cyclohexyl]ethyl]cyclohexyl]propan-2-yl]cyclohexyl]oxymethyl]oxirane (PubChem CID 118282146) has the molecular formula C38H64O6 and a molecular weight of 616.92 g/mol. Its IUPAC name is 2-[[4-[2-[4-[1,1-bis[4-(oxiran-2-ylmethoxy)cyclohexyl]ethyl]cyclohexyl]propan-2-yl]cyclohexyl]oxymethyl]oxirane.
| Compound Name | 2-[[4-[2-[4-[1,1-bis[4-(oxiran-2-ylmethoxy)cyclohexyl]ethyl]cyclohexyl]propan-2-yl]cyclohexyl]oxymethyl]oxirane |
|---|---|
| PubChem CID | 118282146 |
| Molecular Formula | C38H64O6 |
| Molecular Weight | 616.92 g/mol |
| Exact Mass | 616.47 |
| IUPAC Name | 2-[[4-[2-[4-[1,1-bis[4-(oxiran-2-ylmethoxy)cyclohexyl]ethyl]cyclohexyl]propan-2-yl]cyclohexyl]oxymethyl]oxirane |
| SMILES | CC(C)(C1CCC(OCC2CO2)CC1)C1CCC(C(C)(C2CCC(OCC3CO3)CC2)C2CCC(OCC3CO3)CC2)CC1 |
| InChI | InChI=1S/C38H64O6/c1-37(2,27-8-14-31(15-9-27)39-20-34-23-42-34)26-4-6-28(7-5-26)38(3,29-10-16-32(17-11-29)40-21-35-24-43-35)30-12-18-33(19-13-30)41-22-36-25-44-36/h26-36H,4-25H2,1-3H3 |
| InChIKey | PLWWRYGEURZMGU-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 65.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.92 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|