C24H42O3 — CID 140564892
2-[[4-[2-[4-(2,2-dimethylbut-3-enoxy)cyclohexyl]propan-2-yl]cyclohexyl]oxymethyl]oxirane (PubChem CID 140564892) has the molecular formula C24H42O3 and a molecular weight of 378.60 g/mol. Its IUPAC name is 2-[[4-[2-[4-(2,2-dimethylbut-3-enoxy)cyclohexyl]propan-2-yl]cyclohexyl]oxymethyl]oxirane.
| Compound Name | 2-[[4-[2-[4-(2,2-dimethylbut-3-enoxy)cyclohexyl]propan-2-yl]cyclohexyl]oxymethyl]oxirane |
|---|---|
| PubChem CID | 140564892 |
| Molecular Formula | C24H42O3 |
| Molecular Weight | 378.60 g/mol |
| Exact Mass | 378.31 |
| IUPAC Name | 2-[[4-[2-[4-(2,2-dimethylbut-3-enoxy)cyclohexyl]propan-2-yl]cyclohexyl]oxymethyl]oxirane |
| SMILES | C=CC(C)(C)COC1CCC(C(C)(C)C2CCC(OCC3CO3)CC2)CC1 |
| InChI | InChI=1S/C24H42O3/c1-6-23(2,3)17-27-21-13-9-19(10-14-21)24(4,5)18-7-11-20(12-8-18)25-15-22-16-26-22/h6,18-22H,1,7-17H2,2-5H3 |
| InChIKey | HHUNVTQCMUXQNB-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.60 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|