C20H38O4 — CID 138483628
3-[4-[2-[4-(2-hydroxyethoxy)cyclohexyl]propan-2-yl]cyclohexyl]oxypropan-1-ol (PubChem CID 138483628) has the molecular formula C20H38O4 and a molecular weight of 342.52 g/mol. Its IUPAC name is 3-[4-[2-[4-(2-hydroxyethoxy)cyclohexyl]propan-2-yl]cyclohexyl]oxypropan-1-ol.
| Compound Name | 3-[4-[2-[4-(2-hydroxyethoxy)cyclohexyl]propan-2-yl]cyclohexyl]oxypropan-1-ol |
|---|---|
| PubChem CID | 138483628 |
| Molecular Formula | C20H38O4 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.28 |
| IUPAC Name | 3-[4-[2-[4-(2-hydroxyethoxy)cyclohexyl]propan-2-yl]cyclohexyl]oxypropan-1-ol |
| SMILES | CC(C)(C1CCC(OCCO)CC1)C1CCC(OCCCO)CC1 |
| InChI | InChI=1S/C20H38O4/c1-20(2,17-6-10-19(11-7-17)24-15-13-22)16-4-8-18(9-5-16)23-14-3-12-21/h16-19,21-22H,3-15H2,1-2H3 |
| InChIKey | QPWKRUXQUUSYLV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|