C24H48O6 — CID 154735181
2-[2-[2-[2-[2-[4-(2,4,4-trimethylpentan-2-yl)cyclohexyl]oxyethoxy]ethoxy]ethoxy]ethoxy]ethanol (PubChem CID 154735181) has the molecular formula C24H48O6 and a molecular weight of 432.64 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[4-(2,4,4-trimethylpentan-2-yl)cyclohexyl]oxyethoxy]ethoxy]ethoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[2-[2-[2-[4-(2,4,4-trimethylpentan-2-yl)cyclohexyl]oxyethoxy]ethoxy]ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 154735181 |
| Molecular Formula | C24H48O6 |
| Molecular Weight | 432.64 g/mol |
| Exact Mass | 432.35 |
| IUPAC Name | 2-[2-[2-[2-[2-[4-(2,4,4-trimethylpentan-2-yl)cyclohexyl]oxyethoxy]ethoxy]ethoxy]ethoxy]ethanol |
| SMILES | CC(C)(C)CC(C)(C)C1CCC(OCCOCCOCCOCCOCCO)CC1 |
| InChI | InChI=1S/C24H48O6/c1-23(2,3)20-24(4,5)21-6-8-22(9-7-21)30-19-18-29-17-16-28-15-14-27-13-12-26-11-10-25/h21-22,25H,6-20H2,1-5H3 |
| InChIKey | UYCYJPCQLQIGBQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.64 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|