C34H58 — CID 123593546
9-[1-(3-but-3-enylcyclopentyl)cyclobutyl]-2,7-ditert-butyl-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluorene (PubChem CID 123593546) has the molecular formula C34H58 and a molecular weight of 466.84 g/mol. Its IUPAC name is 9-[1-(3-but-3-enylcyclopentyl)cyclobutyl]-2,7-ditert-butyl-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluorene.
| Compound Name | 9-[1-(3-but-3-enylcyclopentyl)cyclobutyl]-2,7-ditert-butyl-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluorene |
|---|---|
| PubChem CID | 123593546 |
| Molecular Formula | C34H58 |
| Molecular Weight | 466.84 g/mol |
| Exact Mass | 466.45 |
| IUPAC Name | 9-[1-(3-but-3-enylcyclopentyl)cyclobutyl]-2,7-ditert-butyl-2,3,4,4a,4b,5,6,7,8,8a,9,9a-dodecahydro-1H-fluorene |
| SMILES | C=CCCC1CCC(C2(C3C4CC(C(C)(C)C)CCC4C4CCC(C(C)(C)C)CC43)CCC2)C1 |
| InChI | InChI=1S/C34H58/c1-8-9-11-23-12-13-26(20-23)34(18-10-19-34)31-29-21-24(32(2,3)4)14-16-27(29)28-17-15-25(22-30(28)31)33(5,6)7/h8,23-31H,1,9-22H2,2-7H3 |
| InChIKey | SKEDKXHNYNEBMD-UHFFFAOYSA-N |
| XLogP | 10.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.84 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|