C14H10F2N2S — CID 105409270
1-[(3,5-difluorophenyl)methyl]-2-thiophen-2-ylimidazole (PubChem CID 105409270) has the molecular formula C14H10F2N2S and a molecular weight of 276.31 g/mol. Its IUPAC name is 1-[(3,5-difluorophenyl)methyl]-2-thiophen-2-ylimidazole.
| Compound Name | 1-[(3,5-difluorophenyl)methyl]-2-thiophen-2-ylimidazole |
|---|---|
| PubChem CID | 105409270 |
| Molecular Formula | C14H10F2N2S |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 1-[(3,5-difluorophenyl)methyl]-2-thiophen-2-ylimidazole |
| SMILES | Fc1cc(F)cc(Cn2ccnc2-c2cccs2)c1 |
| InChI | InChI=1S/C14H10F2N2S/c15-11-6-10(7-12(16)8-11)9-18-4-3-17-14(18)13-2-1-5-19-13/h1-8H,9H2 |
| InChIKey | KWEZMYZFFSGAIK-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |