C20H22BFN2O2S — CID 113249598
1-[[4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-2-thiophen-2-ylimidazole (PubChem CID 113249598) has the molecular formula C20H22BFN2O2S and a molecular weight of 384.29 g/mol. Its IUPAC name is 1-[[4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-2-thiophen-2-ylimidazole.
| Compound Name | 1-[[4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-2-thiophen-2-ylimidazole |
|---|---|
| PubChem CID | 113249598 |
| Molecular Formula | C20H22BFN2O2S |
| Molecular Weight | 384.29 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 1-[[4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-2-thiophen-2-ylimidazole |
| SMILES | CC1(C)OB(c2cc(F)ccc2Cn2ccnc2-c2cccs2)OC1(C)C |
| InChI | InChI=1S/C20H22BFN2O2S/c1-19(2)20(3,4)26-21(25-19)16-12-15(22)8-7-14(16)13-24-10-9-23-18(24)17-6-5-11-27-17/h5-12H,13H2,1-4H3 |
| InChIKey | XOBKGJBASPOBNF-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.29 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|