C15H14F2OS — CID 105409441
1-[3-[(3,5-difluorophenyl)methylsulfanyl]phenyl]ethanol (PubChem CID 105409441) has the molecular formula C15H14F2OS and a molecular weight of 280.34 g/mol. Its IUPAC name is 1-[3-[(3,5-difluorophenyl)methylsulfanyl]phenyl]ethanol.
| Compound Name | 1-[3-[(3,5-difluorophenyl)methylsulfanyl]phenyl]ethanol |
|---|---|
| PubChem CID | 105409441 |
| Molecular Formula | C15H14F2OS |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 1-[3-[(3,5-difluorophenyl)methylsulfanyl]phenyl]ethanol |
| SMILES | CC(O)c1cccc(SCc2cc(F)cc(F)c2)c1 |
| InChI | InChI=1S/C15H14F2OS/c1-10(18)12-3-2-4-15(7-12)19-9-11-5-13(16)8-14(17)6-11/h2-8,10,18H,9H2,1H3 |
| InChIKey | CFZJBCXYYSMGAR-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |