C16H16FNO2S — CID 64666802
N-(3-fluorophenyl)-2-[3-(1-hydroxyethyl)phenyl]sulfanylacetamide (PubChem CID 64666802) has the molecular formula C16H16FNO2S and a molecular weight of 305.37 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-[3-(1-hydroxyethyl)phenyl]sulfanylacetamide.
| Compound Name | N-(3-fluorophenyl)-2-[3-(1-hydroxyethyl)phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 64666802 |
| Molecular Formula | C16H16FNO2S |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | N-(3-fluorophenyl)-2-[3-(1-hydroxyethyl)phenyl]sulfanylacetamide |
| SMILES | CC(O)c1cccc(SCC(=O)Nc2cccc(F)c2)c1 |
| InChI | InChI=1S/C16H16FNO2S/c1-11(19)12-4-2-7-15(8-12)21-10-16(20)18-14-6-3-5-13(17)9-14/h2-9,11,19H,10H2,1H3,(H,18,20) |
| InChIKey | YEQFIAHZVDODGJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |